About 9H-fluorene;3-iodo-9H-fluorene
9H-fluorene;3-iodo-9H-fluorene (PubChem CID 169429949) has the molecular formula C26H19I
and a molecular weight of 458.34 g/mol. Its IUPAC name is 9H-fluorene;3-iodo-9H-fluorene.
Molecular Properties
| Compound Name | 9H-fluorene;3-iodo-9H-fluorene |
| PubChem CID | 169429949 |
| Molecular Formula | C26H19I |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 9H-fluorene;3-iodo-9H-fluorene |
| SMILES | Ic1ccc2c(c1)-c1ccccc1C2.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H9I.C13H10/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-6,8H,7H2;1-8H,9H2 |
| InChIKey | SQECHHUCCZSXGO-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene;3-iodo-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;3-iodo-9H-fluorene?
The IUPAC name of 9H-fluorene;3-iodo-9H-fluorene (CID 169429949) is 9H-fluorene;3-iodo-9H-fluorene.
What is the SMILES notation for 9H-fluorene;3-iodo-9H-fluorene?
The canonical SMILES for 9H-fluorene;3-iodo-9H-fluorene is Ic1ccc2c(c1)-c1ccccc1C2.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;3-iodo-9H-fluorene?
The InChIKey is SQECHHUCCZSXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9I.C13H10/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-6,8H,7H2;1-8H,9H2.
What are the key properties of 9H-fluorene;3-iodo-9H-fluorene?
9H-fluorene;3-iodo-9H-fluorene has a molecular weight of 458.34 g/mol, XLogP of 7.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;3-iodo-9H-fluorene is sourced from PubChem (CID 169429949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).