About 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane
1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane (PubChem CID 159720979) has the molecular formula C29H27I2NO
and a molecular weight of 659.35 g/mol. Its IUPAC name is 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane.
Molecular Properties
| Compound Name | 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane |
| PubChem CID | 159720979 |
| Molecular Formula | C29H27I2NO |
| Molecular Weight | 659.35 g/mol |
| Exact Mass | 659.02 |
| IUPAC Name | 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane |
| SMILES | C.C.CC(=O)n1c2ccccc2c2cc(I)ccc21.Ic1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C14H10INO.C13H9I.2CH4/c1-9(17)16-13-5-3-2-4-11(13)12-8-10(15)6-7-14(12)16;14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11;;/h2-8H,1H3;1-6,8H,7H2;2*1H4 |
| InChIKey | NAAMOJQVLRZTSV-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 659.35 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane?
The IUPAC name of 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane (CID 159720979) is 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane.
What is the SMILES notation for 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane?
The canonical SMILES for 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane is C.C.CC(=O)n1c2ccccc2c2cc(I)ccc21.Ic1ccc2c(c1)-c1ccccc1C2.
What is the InChIKey of 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane?
The InChIKey is NAAMOJQVLRZTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10INO.C13H9I.2CH4/c1-9(17)16-13-5-3-2-4-11(13)12-8-10(15)6-7-14(12)16;14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11;;/h2-8H,1H3;1-6,8H,7H2;2*1H4.
What are the key properties of 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane?
1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane has a molecular weight of 659.35 g/mol, XLogP of 9.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-iodocarbazol-9-yl)ethanone;3-iodo-9H-fluorene;methane is sourced from PubChem (CID 159720979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).