C14H6O2 — CID 146015026
14-oxapentacyclo[7.6.0.02,7.010,12.013,15]pentadeca-1(15),2,4,6,9,12-hexaen-11-one (PubChem CID 146015026) has the molecular formula C14H6O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 14-oxapentacyclo[7.6.0.02,7.010,12.013,15]pentadeca-1(15),2,4,6,9,12-hexaen-11-one.
| Compound Name | 14-oxapentacyclo[7.6.0.02,7.010,12.013,15]pentadeca-1(15),2,4,6,9,12-hexaen-11-one |
|---|---|
| PubChem CID | 146015026 |
| Molecular Formula | C14H6O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 14-oxapentacyclo[7.6.0.02,7.010,12.013,15]pentadeca-1(15),2,4,6,9,12-hexaen-11-one |
| SMILES | O=c1c2c3c(c4c(c12)O4)-c1ccccc1C3 |
| InChI | InChI=1S/C14H6O2/c15-12-10-8-5-6-3-1-2-4-7(6)9(8)13-14(16-13)11(10)12/h1-4H,5H2 |
| InChIKey | JGJXZCPAQYTFMD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|