C11H11NO6 — CID 15672399
dimethyl 5-formyl-6-methoxypyridine-2,3-dicarboxylate (PubChem CID 15672399) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is dimethyl 5-formyl-6-methoxypyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 5-formyl-6-methoxypyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15672399 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | dimethyl 5-formyl-6-methoxypyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C=O)c(OC)nc1C(=O)OC |
| InChI | InChI=1S/C11H11NO6/c1-16-9-6(5-13)4-7(10(14)17-2)8(12-9)11(15)18-3/h4-5H,1-3H3 |
| InChIKey | KMESINBPPYWRKL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|