C9H7F5N2O3 — CID 118801555
4-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)pyridine-2-carboxylic acid (PubChem CID 118801555) has the molecular formula C9H7F5N2O3 and a molecular weight of 286.16 g/mol. Its IUPAC name is 4-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)pyridine-2-carboxylic acid.
| Compound Name | 4-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118801555 |
| Molecular Formula | C9H7F5N2O3 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)pyridine-2-carboxylic acid |
| SMILES | NCc1cc(C(=O)O)nc(OC(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C9H7F5N2O3/c10-6(11)5-3(2-15)1-4(8(17)18)16-7(5)19-9(12,13)14/h1,6H,2,15H2,(H,17,18) |
| InChIKey | KYKZNCQGEVRVAU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |