C8H3F5N2O5 — CID 118805923
4-(difluoromethyl)-5-nitro-6-(trifluoromethoxy)pyridine-2-carboxylic acid (PubChem CID 118805923) has the molecular formula C8H3F5N2O5 and a molecular weight of 302.11 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-nitro-6-(trifluoromethoxy)pyridine-2-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-5-nitro-6-(trifluoromethoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118805923 |
| Molecular Formula | C8H3F5N2O5 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 4-(difluoromethyl)-5-nitro-6-(trifluoromethoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)F)c([N+](=O)[O-])c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C8H3F5N2O5/c9-5(10)2-1-3(7(16)17)14-6(4(2)15(18)19)20-8(11,12)13/h1,5H,(H,16,17) |
| InChIKey | MJYKGKFPCOZNSY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|