C9H8F4N2O3 — CID 119003450
2-[2-amino-6-(fluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetic acid (PubChem CID 119003450) has the molecular formula C9H8F4N2O3 and a molecular weight of 268.17 g/mol. Its IUPAC name is 2-[2-amino-6-(fluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetic acid.
| Compound Name | 2-[2-amino-6-(fluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 119003450 |
| Molecular Formula | C9H8F4N2O3 |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[2-amino-6-(fluoromethyl)-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
| SMILES | Nc1nc(CF)cc(OC(F)(F)F)c1CC(=O)O |
| InChI | InChI=1S/C9H8F4N2O3/c10-3-4-1-6(18-9(11,12)13)5(2-7(16)17)8(14)15-4/h1H,2-3H2,(H2,14,15)(H,16,17) |
| InChIKey | JJBBDOVKROITCQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |