About 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid
5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid (PubChem CID 94701090) has the molecular formula C13H13NO4S
and a molecular weight of 279.32 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid |
| PubChem CID | 94701090 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid |
| SMILES | COc1ccc(-c2sc(C(=O)O)nc2C)cc1OC |
| InChI | InChI=1S/C13H13NO4S/c1-7-11(19-12(14-7)13(15)16)8-4-5-9(17-2)10(6-8)18-3/h4-6H,1-3H3,(H,15,16) |
| InChIKey | UZTXTVDXIVTJCG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid (CID 94701090) is 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid is COc1ccc(-c2sc(C(=O)O)nc2C)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid?
The InChIKey is UZTXTVDXIVTJCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4S/c1-7-11(19-12(14-7)13(15)16)8-4-5-9(17-2)10(6-8)18-3/h4-6H,1-3H3,(H,15,16).
What are the key properties of 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid?
5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid has a molecular weight of 279.32 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 94701090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).