C34H52O8Sn — CID 159937238
bis(2,3-dimethoxybenzoate);dioctyltin(2+) (PubChem CID 159937238) has the molecular formula C34H52O8Sn and a molecular weight of 707.49 g/mol. Its IUPAC name is bis(2,3-dimethoxybenzoate);dioctyltin(2+).
| Compound Name | bis(2,3-dimethoxybenzoate);dioctyltin(2+) |
|---|---|
| PubChem CID | 159937238 |
| Molecular Formula | C34H52O8Sn |
| Molecular Weight | 707.49 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | bis(2,3-dimethoxybenzoate);dioctyltin(2+) |
| SMILES | CCCCCCCC[Sn+2]CCCCCCCC.COc1cccc(C(=O)[O-])c1OC.COc1cccc(C(=O)[O-])c1OC |
| InChI | InChI=1S/2C9H10O4.2C8H17.Sn/c2*1-12-7-5-3-4-6(9(10)11)8(7)13-2;2*1-3-5-7-8-6-4-2;/h2*3-5H,1-2H3,(H,10,11);2*1,3-8H2,2H3;/q;;;;+2/p-2 |
| InChIKey | OAKGYEGTJZFKQX-UHFFFAOYSA-L |
| XLogP | 6.38 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|