About 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide
2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide (PubChem CID 21128413) has the molecular formula C19H31INO6-
and a molecular weight of 496.36 g/mol. Its IUPAC name is 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide.
Molecular Properties
| Compound Name | 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide |
| PubChem CID | 21128413 |
| Molecular Formula | C19H31INO6- |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide |
| SMILES | CCCCOc1c(OC)cccc1C(=O)[O-].C[N+]1(CCO)CCOCC1.[I-] |
| InChI | InChI=1S/C12H16O4.C7H16NO2.HI/c1-3-4-8-16-11-9(12(13)14)6-5-7-10(11)15-2;1-8(2-5-9)3-6-10-7-4-8;/h5-7H,3-4,8H2,1-2H3,(H,13,14);9H,2-7H2,1H3;1H/q;+1;/p-2 |
| InChIKey | ZJEVRIWNONOBIX-UHFFFAOYSA-L |
| XLogP | -2.30 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide?
The IUPAC name of 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide (CID 21128413) is 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide.
What is the SMILES notation for 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide?
The canonical SMILES for 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide is CCCCOc1c(OC)cccc1C(=O)[O-].C[N+]1(CCO)CCOCC1.[I-].
What is the InChIKey of 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide?
The InChIKey is ZJEVRIWNONOBIX-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H16O4.C7H16NO2.HI/c1-3-4-8-16-11-9(12(13)14)6-5-7-10(11)15-2;1-8(2-5-9)3-6-10-7-4-8;/h5-7H,3-4,8H2,1-2H3,(H,13,14);9H,2-7H2,1H3;1H/q;+1;/p-2.
What are the key properties of 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide?
2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide has a molecular weight of 496.36 g/mol, XLogP of -2.30, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-3-methoxybenzoate;2-(4-methylmorpholin-4-ium-4-yl)ethanol;iodide is sourced from PubChem (CID 21128413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).