C29H41BrN2O5 — CID 3039981
2-(4-methylmorpholin-4-ium-4-yl)ethyl 4-[(2-octoxybenzoyl)amino]benzoate bromide (PubChem CID 3039981) has the molecular formula C29H41BrN2O5 and a molecular weight of 577.56 g/mol. Its IUPAC name is 2-(4-methylmorpholin-4-ium-4-yl)ethyl 4-[(2-octoxybenzoyl)amino]benzoate bromide.
| Compound Name | 2-(4-methylmorpholin-4-ium-4-yl)ethyl 4-[(2-octoxybenzoyl)amino]benzoate bromide |
|---|---|
| PubChem CID | 3039981 |
| Molecular Formula | C29H41BrN2O5 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 2-(4-methylmorpholin-4-ium-4-yl)ethyl 4-[(2-octoxybenzoyl)amino]benzoate bromide |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)OCC[N+]2(C)CCOCC2)cc1.[Br-] |
| InChI | InChI=1S/C29H40N2O5.BrH/c1-3-4-5-6-7-10-20-35-27-12-9-8-11-26(27)28(32)30-25-15-13-24(14-16-25)29(33)36-23-19-31(2)17-21-34-22-18-31;/h8-9,11-16H,3-7,10,17-23H2,1-2H3;1H |
| InChIKey | HXGCJZGOMZVWTH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|