C30H44N3O3+ — CID 154676447
N-[4-[(1-ethyl-1-methylpiperidin-1-ium-4-yl)carbamoyl]phenyl]-2-octoxybenzamide (PubChem CID 154676447) has the molecular formula C30H44N3O3+ and a molecular weight of 494.70 g/mol. Its IUPAC name is N-[4-[(1-ethyl-1-methylpiperidin-1-ium-4-yl)carbamoyl]phenyl]-2-octoxybenzamide.
| Compound Name | N-[4-[(1-ethyl-1-methylpiperidin-1-ium-4-yl)carbamoyl]phenyl]-2-octoxybenzamide |
|---|---|
| PubChem CID | 154676447 |
| Molecular Formula | C30H44N3O3+ |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | N-[4-[(1-ethyl-1-methylpiperidin-1-ium-4-yl)carbamoyl]phenyl]-2-octoxybenzamide |
| SMILES | CCCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)NC2CC[N+](C)(CC)CC2)cc1 |
| InChI | InChI=1S/C30H43N3O3/c1-4-6-7-8-9-12-23-36-28-14-11-10-13-27(28)30(35)32-25-17-15-24(16-18-25)29(34)31-26-19-21-33(3,5-2)22-20-26/h10-11,13-18,26H,4-9,12,19-23H2,1-3H3,(H-,31,32,34,35)/p+1 |
| InChIKey | VMAXVNTZUJDLOQ-UHFFFAOYSA-O |
| XLogP | 6.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|