C32H48N3O3+ — CID 154676394
N-[4-[(1,1-dipropylpiperidin-1-ium-4-yl)carbamoyl]phenyl]-2-heptoxybenzamide (PubChem CID 154676394) has the molecular formula C32H48N3O3+ and a molecular weight of 522.75 g/mol. Its IUPAC name is N-[4-[(1,1-dipropylpiperidin-1-ium-4-yl)carbamoyl]phenyl]-2-heptoxybenzamide.
| Compound Name | N-[4-[(1,1-dipropylpiperidin-1-ium-4-yl)carbamoyl]phenyl]-2-heptoxybenzamide |
|---|---|
| PubChem CID | 154676394 |
| Molecular Formula | C32H48N3O3+ |
| Molecular Weight | 522.75 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | N-[4-[(1,1-dipropylpiperidin-1-ium-4-yl)carbamoyl]phenyl]-2-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)NC2CC[N+](CCC)(CCC)CC2)cc1 |
| InChI | InChI=1S/C32H47N3O3/c1-4-7-8-9-12-25-38-30-14-11-10-13-29(30)32(37)34-27-17-15-26(16-18-27)31(36)33-28-19-23-35(21-5-2,22-6-3)24-20-28/h10-11,13-18,28H,4-9,12,19-25H2,1-3H3,(H-,33,34,36,37)/p+1 |
| InChIKey | GCKDKTHLVVHYKX-UHFFFAOYSA-O |
| XLogP | 6.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.75 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|