C18H13F2NO2 — CID 3881331
2-(2,4-difluorophenyl)-5,8-dimethylquinoline-4-carboxylic acid (PubChem CID 3881331) has the molecular formula C18H13F2NO2 and a molecular weight of 313.30 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-5,8-dimethylquinoline-4-carboxylic acid.
| Compound Name | 2-(2,4-difluorophenyl)-5,8-dimethylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3881331 |
| Molecular Formula | C18H13F2NO2 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)-5,8-dimethylquinoline-4-carboxylic acid |
| SMILES | Cc1ccc(C)c2c(C(=O)O)cc(-c3ccc(F)cc3F)nc12 |
| InChI | InChI=1S/C18H13F2NO2/c1-9-3-4-10(2)17-16(9)13(18(22)23)8-15(21-17)12-6-5-11(19)7-14(12)20/h3-8H,1-2H3,(H,22,23) |
| InChIKey | IMVHSIYVIYSCAO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |