C17H10ClF2NO2 — CID 4579091
5-chloro-2-(2,4-difluorophenyl)-8-methylquinoline-4-carboxylic acid (PubChem CID 4579091) has the molecular formula C17H10ClF2NO2 and a molecular weight of 333.72 g/mol. Its IUPAC name is 5-chloro-2-(2,4-difluorophenyl)-8-methylquinoline-4-carboxylic acid.
| Compound Name | 5-chloro-2-(2,4-difluorophenyl)-8-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4579091 |
| Molecular Formula | C17H10ClF2NO2 |
| Molecular Weight | 333.72 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 5-chloro-2-(2,4-difluorophenyl)-8-methylquinoline-4-carboxylic acid |
| SMILES | Cc1ccc(Cl)c2c(C(=O)O)cc(-c3ccc(F)cc3F)nc12 |
| InChI | InChI=1S/C17H10ClF2NO2/c1-8-2-5-12(18)15-11(17(22)23)7-14(21-16(8)15)10-4-3-9(19)6-13(10)20/h2-7H,1H3,(H,22,23) |
| InChIKey | XWJYJNHKNRDLDU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |