C19H12ClNO3 — CID 5024096
2-(1-benzofuran-2-yl)-5-chloro-8-methylquinoline-4-carboxylic acid (PubChem CID 5024096) has the molecular formula C19H12ClNO3 and a molecular weight of 337.76 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-5-chloro-8-methylquinoline-4-carboxylic acid.
| Compound Name | 2-(1-benzofuran-2-yl)-5-chloro-8-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 5024096 |
| Molecular Formula | C19H12ClNO3 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-5-chloro-8-methylquinoline-4-carboxylic acid |
| SMILES | Cc1ccc(Cl)c2c(C(=O)O)cc(-c3cc4ccccc4o3)nc12 |
| InChI | InChI=1S/C19H12ClNO3/c1-10-6-7-13(20)17-12(19(22)23)9-14(21-18(10)17)16-8-11-4-2-3-5-15(11)24-16/h2-9H,1H3,(H,22,23) |
| InChIKey | UROIVMOVLNZQRB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |