C21H17NO4 — CID 140923725
5-methoxy-8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid (PubChem CID 140923725) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is 5-methoxy-8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid.
| Compound Name | 5-methoxy-8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 140923725 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 5-methoxy-8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid |
| SMILES | COc1ccc(C)c2nc(-c3oc4ccccc4c3C)cc(C(=O)O)c12 |
| InChI | InChI=1S/C21H17NO4/c1-11-8-9-17(25-3)18-14(21(23)24)10-15(22-19(11)18)20-12(2)13-6-4-5-7-16(13)26-20/h4-10H,1-3H3,(H,23,24) |
| InChIKey | UDFRXQKVJWKKAI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |