C27H20N2O4 — CID 126751216
5-benzamido-8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid (PubChem CID 126751216) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 5-benzamido-8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid.
| Compound Name | 5-benzamido-8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 126751216 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 5-benzamido-8-methyl-2-(3-methyl-1-benzofuran-2-yl)quinoline-4-carboxylic acid |
| SMILES | Cc1c(-c2cc(C(=O)O)c3c(NC(=O)c4ccccc4)ccc(C)c3n2)oc2ccccc12 |
| InChI | InChI=1S/C27H20N2O4/c1-15-12-13-20(29-26(30)17-8-4-3-5-9-17)23-19(27(31)32)14-21(28-24(15)23)25-16(2)18-10-6-7-11-22(18)33-25/h3-14H,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | NZBKOHDPUMHKHS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |