C19H14F2N2O4 — CID 18073443
6-acetamido-2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylic acid (PubChem CID 18073443) has the molecular formula C19H14F2N2O4 and a molecular weight of 372.33 g/mol. Its IUPAC name is 6-acetamido-2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 6-acetamido-2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 18073443 |
| Molecular Formula | C19H14F2N2O4 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 6-acetamido-2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylic acid |
| SMILES | CC(=O)Nc1ccc2nc(-c3ccc(OC(F)F)cc3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C19H14F2N2O4/c1-10(24)22-12-4-7-16-14(8-12)15(18(25)26)9-17(23-16)11-2-5-13(6-3-11)27-19(20)21/h2-9,19H,1H3,(H,22,24)(H,25,26) |
| InChIKey | RTKONTIPEXDMIE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |