C16H16N6O — CID 56896945
4-(1H-imidazo[4,5-b]pyridin-5-yl)-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 56896945) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is 4-(1H-imidazo[4,5-b]pyridin-5-yl)-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine.
| Compound Name | 4-(1H-imidazo[4,5-b]pyridin-5-yl)-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 56896945 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-(1H-imidazo[4,5-b]pyridin-5-yl)-N-(2-methoxyethyl)-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | COCCNc1cc(-c2ccc3[nH]cnc3n2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C16H16N6O/c1-23-7-6-17-14-8-11(10-4-5-18-15(10)22-14)12-2-3-13-16(21-12)20-9-19-13/h2-5,8-9H,6-7H2,1H3,(H2,17,18,22)(H,19,20,21) |
| InChIKey | CRRXYWFVPARNFE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|