C16H18N8O — CID 90994686
2-[2-(1H-indazol-6-yl)hydrazinyl]-N-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 90994686) has the molecular formula C16H18N8O and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-[2-(1H-indazol-6-yl)hydrazinyl]-N-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[2-(1H-indazol-6-yl)hydrazinyl]-N-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90994686 |
| Molecular Formula | C16H18N8O |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-[2-(1H-indazol-6-yl)hydrazinyl]-N-(2-methoxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COCCNc1nc(NNc2ccc3cn[nH]c3c2)nc2[nH]ccc12 |
| InChI | InChI=1S/C16H18N8O/c1-25-7-6-18-15-12-4-5-17-14(12)20-16(21-15)24-22-11-3-2-10-9-19-23-13(10)8-11/h2-5,8-9,22H,6-7H2,1H3,(H,19,23)(H3,17,18,20,21,24) |
| InChIKey | DAXRFYNBHYORGQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|