C15H16N8O — CID 91219468
2-[[2-[2-(1H-indazol-6-yl)hydrazinyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethanol (PubChem CID 91219468) has the molecular formula C15H16N8O and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-[[2-[2-(1H-indazol-6-yl)hydrazinyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-[2-(1H-indazol-6-yl)hydrazinyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 91219468 |
| Molecular Formula | C15H16N8O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[[2-[2-(1H-indazol-6-yl)hydrazinyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethanol |
| SMILES | OCCNc1nc(NNc2ccc3cn[nH]c3c2)nc2[nH]ccc12 |
| InChI | InChI=1S/C15H16N8O/c24-6-5-17-14-11-3-4-16-13(11)19-15(20-14)23-21-10-2-1-9-8-18-22-12(9)7-10/h1-4,7-8,21,24H,5-6H2,(H,18,22)(H3,16,17,19,20,23) |
| InChIKey | IJXFJCXEFCZUHQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|