C12H11F4N3O — CID 110431775
8-fluoro-N-(2-methoxyethyl)-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 110431775) has the molecular formula C12H11F4N3O and a molecular weight of 289.23 g/mol. Its IUPAC name is 8-fluoro-N-(2-methoxyethyl)-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 8-fluoro-N-(2-methoxyethyl)-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 110431775 |
| Molecular Formula | C12H11F4N3O |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 8-fluoro-N-(2-methoxyethyl)-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COCCNc1nc(C(F)(F)F)nc2c(F)cccc12 |
| InChI | InChI=1S/C12H11F4N3O/c1-20-6-5-17-10-7-3-2-4-8(13)9(7)18-11(19-10)12(14,15)16/h2-4H,5-6H2,1H3,(H,17,18,19) |
| InChIKey | HHLUJRJGKGBQCW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|