C14H13F4N3O — CID 110431777
8-fluoro-N-(oxolan-2-ylmethyl)-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 110431777) has the molecular formula C14H13F4N3O and a molecular weight of 315.27 g/mol. Its IUPAC name is 8-fluoro-N-(oxolan-2-ylmethyl)-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 8-fluoro-N-(oxolan-2-ylmethyl)-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 110431777 |
| Molecular Formula | C14H13F4N3O |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 8-fluoro-N-(oxolan-2-ylmethyl)-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | Fc1cccc2c(NCC3CCCO3)nc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C14H13F4N3O/c15-10-5-1-4-9-11(10)20-13(14(16,17)18)21-12(9)19-7-8-3-2-6-22-8/h1,4-5,8H,2-3,6-7H2,(H,19,20,21) |
| InChIKey | ASPKAKKHUNJSFJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |