C18H24N4O — CID 3156007
N-(oxolan-2-ylmethyl)-2-piperidin-1-ylquinazolin-4-amine (PubChem CID 3156007) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-piperidin-1-ylquinazolin-4-amine.
| Compound Name | N-(oxolan-2-ylmethyl)-2-piperidin-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 3156007 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-piperidin-1-ylquinazolin-4-amine |
| SMILES | c1ccc2c(NCC3CCCO3)nc(N3CCCCC3)nc2c1 |
| InChI | InChI=1S/C18H24N4O/c1-4-10-22(11-5-1)18-20-16-9-3-2-8-15(16)17(21-18)19-13-14-7-6-12-23-14/h2-3,8-9,14H,1,4-7,10-13H2,(H,19,20,21) |
| InChIKey | ZPWNVDMZEZGFML-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |