C20H26ClN3O — CID 7456798
N-[(2-chloro-4-piperidin-1-ylquinolin-3-yl)methyl]-1-[(2S)-oxolan-2-yl]methanamine (PubChem CID 7456798) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is N-[(2-chloro-4-piperidin-1-ylquinolin-3-yl)methyl]-1-[(2S)-oxolan-2-yl]methanamine.
| Compound Name | N-[(2-chloro-4-piperidin-1-ylquinolin-3-yl)methyl]-1-[(2S)-oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 7456798 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[(2-chloro-4-piperidin-1-ylquinolin-3-yl)methyl]-1-[(2S)-oxolan-2-yl]methanamine |
| SMILES | Clc1nc2ccccc2c(N2CCCCC2)c1CNC[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H26ClN3O/c21-20-17(14-22-13-15-7-6-12-25-15)19(24-10-4-1-5-11-24)16-8-2-3-9-18(16)23-20/h2-3,8-9,15,22H,1,4-7,10-14H2/t15-/m0/s1 |
| InChIKey | KOELIPIJQZKMQZ-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|