C17H22ClN4O2- — CID 53351083
2-morpholin-4-yl-N-(oxolan-2-ylmethyl)quinazolin-4-amine chloride (PubChem CID 53351083) has the molecular formula C17H22ClN4O2- and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(oxolan-2-ylmethyl)quinazolin-4-amine chloride.
| Compound Name | 2-morpholin-4-yl-N-(oxolan-2-ylmethyl)quinazolin-4-amine chloride |
|---|---|
| PubChem CID | 53351083 |
| Molecular Formula | C17H22ClN4O2- |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-morpholin-4-yl-N-(oxolan-2-ylmethyl)quinazolin-4-amine chloride |
| SMILES | [Cl-].c1ccc2c(NCC3CCCO3)nc(N3CCOCC3)nc2c1 |
| InChI | InChI=1S/C17H22N4O2.ClH/c1-2-6-15-14(5-1)16(18-12-13-4-3-9-23-13)20-17(19-15)21-7-10-22-11-8-21;/h1-2,5-6,13H,3-4,7-12H2,(H,18,19,20);1H/p-1 |
| InChIKey | XJOYQBZPAVVQBT-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |