C20H19N3O — CID 90670027
N-(oxolan-2-ylmethyl)-11H-indolo[3,2-c]quinolin-6-amine (PubChem CID 90670027) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-11H-indolo[3,2-c]quinolin-6-amine.
| Compound Name | N-(oxolan-2-ylmethyl)-11H-indolo[3,2-c]quinolin-6-amine |
|---|---|
| PubChem CID | 90670027 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-11H-indolo[3,2-c]quinolin-6-amine |
| SMILES | c1ccc2c(c1)nc(NCC1CCCO1)c1c3ccccc3[nH]c21 |
| InChI | InChI=1S/C20H19N3O/c1-3-9-16-14(7-1)18-19(22-16)15-8-2-4-10-17(15)23-20(18)21-12-13-6-5-11-24-13/h1-4,7-10,13,22H,5-6,11-12H2,(H,21,23) |
| InChIKey | RONBXELJMWJNNL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |