C12H14N2OS — CID 63373288
N-(oxolan-2-ylmethyl)-2,1-benzothiazol-3-amine (PubChem CID 63373288) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2,1-benzothiazol-3-amine.
| Compound Name | N-(oxolan-2-ylmethyl)-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 63373288 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2,1-benzothiazol-3-amine |
| SMILES | c1ccc2c(NCC3CCCO3)snc2c1 |
| InChI | InChI=1S/C12H14N2OS/c1-2-6-11-10(5-1)12(16-14-11)13-8-9-4-3-7-15-9/h1-2,5-6,9,13H,3-4,7-8H2 |
| InChIKey | JEXZXVJTOSQDSJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |