C15H18F3N3O3 — CID 110431469
7,8-dimethoxy-N-(3-methoxypropyl)-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 110431469) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 7,8-dimethoxy-N-(3-methoxypropyl)-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 7,8-dimethoxy-N-(3-methoxypropyl)-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 110431469 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 7,8-dimethoxy-N-(3-methoxypropyl)-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COCCCNc1nc(C(F)(F)F)nc2c(OC)c(OC)ccc12 |
| InChI | InChI=1S/C15H18F3N3O3/c1-22-8-4-7-19-13-9-5-6-10(23-2)12(24-3)11(9)20-14(21-13)15(16,17)18/h5-6H,4,7-8H2,1-3H3,(H,19,20,21) |
| InChIKey | CHMUHPUSPDJDJH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|