C15H17F4N3 — CID 110431796
8-fluoro-N-hexyl-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 110431796) has the molecular formula C15H17F4N3 and a molecular weight of 315.31 g/mol. Its IUPAC name is 8-fluoro-N-hexyl-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 8-fluoro-N-hexyl-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 110431796 |
| Molecular Formula | C15H17F4N3 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 8-fluoro-N-hexyl-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | CCCCCCNc1nc(C(F)(F)F)nc2c(F)cccc12 |
| InChI | InChI=1S/C15H17F4N3/c1-2-3-4-5-9-20-13-10-7-6-8-11(16)12(10)21-14(22-13)15(17,18)19/h6-8H,2-5,9H2,1H3,(H,20,21,22) |
| InChIKey | OKHYHEPWYNTCBR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|