C16H20F3N3O — CID 154835565
N-[3-(2-methylpropoxy)propyl]-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 154835565) has the molecular formula C16H20F3N3O and a molecular weight of 327.35 g/mol. Its IUPAC name is N-[3-(2-methylpropoxy)propyl]-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-[3-(2-methylpropoxy)propyl]-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 154835565 |
| Molecular Formula | C16H20F3N3O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[3-(2-methylpropoxy)propyl]-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | CC(C)COCCCNc1nc(C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C16H20F3N3O/c1-11(2)10-23-9-5-8-20-14-12-6-3-4-7-13(12)21-15(22-14)16(17,18)19/h3-4,6-7,11H,5,8-10H2,1-2H3,(H,20,21,22) |
| InChIKey | GWGROFQDLLVLFR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|