C14H14ClF3N4O — CID 112885975
4-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-N-(2-methoxyethyl)pyrimidine-2,4-diamine (PubChem CID 112885975) has the molecular formula C14H14ClF3N4O and a molecular weight of 346.74 g/mol. Its IUPAC name is 4-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-N-(2-methoxyethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-N-(2-methoxyethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112885975 |
| Molecular Formula | C14H14ClF3N4O |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-N-(2-methoxyethyl)pyrimidine-2,4-diamine |
| SMILES | COCCNc1nccc(Nc2ccc(Cl)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H14ClF3N4O/c1-23-7-6-20-13-19-5-4-12(22-13)21-11-3-2-9(15)8-10(11)14(16,17)18/h2-5,8H,6-7H2,1H3,(H2,19,20,21,22) |
| InChIKey | FHOZWXYDIRCBGO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|