C15H16ClF3N4 — CID 112883125
2-N-butyl-4-N-[4-chloro-2-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 112883125) has the molecular formula C15H16ClF3N4 and a molecular weight of 344.77 g/mol. Its IUPAC name is 2-N-butyl-4-N-[4-chloro-2-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N-[4-chloro-2-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112883125 |
| Molecular Formula | C15H16ClF3N4 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-N-butyl-4-N-[4-chloro-2-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nccc(Nc2ccc(Cl)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C15H16ClF3N4/c1-2-3-7-20-14-21-8-6-13(23-14)22-12-5-4-10(16)9-11(12)15(17,18)19/h4-6,8-9H,2-3,7H2,1H3,(H2,20,21,22,23) |
| InChIKey | XGUUWVIOYWSMID-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|