C14H12ClF3N4 — CID 112882632
2-N-[4-chloro-2-(trifluoromethyl)phenyl]-4-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112882632) has the molecular formula C14H12ClF3N4 and a molecular weight of 328.73 g/mol. Its IUPAC name is 2-N-[4-chloro-2-(trifluoromethyl)phenyl]-4-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-chloro-2-(trifluoromethyl)phenyl]-4-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112882632 |
| Molecular Formula | C14H12ClF3N4 |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-N-[4-chloro-2-(trifluoromethyl)phenyl]-4-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1ccnc(Nc2ccc(Cl)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H12ClF3N4/c1-2-6-19-12-5-7-20-13(22-12)21-11-4-3-9(15)8-10(11)14(16,17)18/h2-5,7-8H,1,6H2,(H2,19,20,21,22) |
| InChIKey | JWYGGNWJUMRWJJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|