C17H16F4N2O3 — CID 70270019
6-(3-fluoro-4-methylphenyl)-2-(2-methoxyethylamino)-4-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 70270019) has the molecular formula C17H16F4N2O3 and a molecular weight of 372.32 g/mol. Its IUPAC name is 6-(3-fluoro-4-methylphenyl)-2-(2-methoxyethylamino)-4-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 6-(3-fluoro-4-methylphenyl)-2-(2-methoxyethylamino)-4-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70270019 |
| Molecular Formula | C17H16F4N2O3 |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 6-(3-fluoro-4-methylphenyl)-2-(2-methoxyethylamino)-4-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | COCCNc1nc(-c2ccc(C)c(F)c2)cc(C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C17H16F4N2O3/c1-9-3-4-10(7-12(9)18)13-8-11(17(19,20)21)14(16(24)25)15(23-13)22-5-6-26-2/h3-4,7-8H,5-6H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | NUHLZLQWCKADLL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|