C22H30N4O2 — CID 126474320
[6-(3,4-dimethylphenyl)-2-(2-methoxyethylamino)-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 126474320) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is [6-(3,4-dimethylphenyl)-2-(2-methoxyethylamino)-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [6-(3,4-dimethylphenyl)-2-(2-methoxyethylamino)-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 126474320 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | [6-(3,4-dimethylphenyl)-2-(2-methoxyethylamino)-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | COCCNc1nc(-c2ccc(C)c(C)c2)ccc1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C22H30N4O2/c1-16-5-6-18(15-17(16)2)20-8-7-19(21(24-20)23-9-14-28-4)22(27)26-12-10-25(3)11-13-26/h5-8,15H,9-14H2,1-4H3,(H,23,24) |
| InChIKey | BLQGTEIPXRJLLE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|