C19H25N3O5 — CID 126471461
2-(2-methoxyethylamino)-N-methyl-6-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 126471461) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-methyl-6-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 2-(2-methoxyethylamino)-N-methyl-6-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126471461 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-methyl-6-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2cc(OC)c(OC)c(OC)c2)nc1NCCOC |
| InChI | InChI=1S/C19H25N3O5/c1-20-19(23)13-6-7-14(22-18(13)21-8-9-24-2)12-10-15(25-3)17(27-5)16(11-12)26-4/h6-7,10-11H,8-9H2,1-5H3,(H,20,23)(H,21,22) |
| InChIKey | OUIBJJSUMCAKAL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|