C18H24N4O5 — CID 109323649
2-(2-methoxyethylamino)-6-methyl-N-(3,4,5-trimethoxyphenyl)pyrimidine-4-carboxamide (PubChem CID 109323649) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-6-methyl-N-(3,4,5-trimethoxyphenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(2-methoxyethylamino)-6-methyl-N-(3,4,5-trimethoxyphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323649 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-(2-methoxyethylamino)-6-methyl-N-(3,4,5-trimethoxyphenyl)pyrimidine-4-carboxamide |
| SMILES | COCCNc1nc(C)cc(C(=O)Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C18H24N4O5/c1-11-8-13(22-18(20-11)19-6-7-24-2)17(23)21-12-9-14(25-3)16(27-5)15(10-12)26-4/h8-10H,6-7H2,1-5H3,(H,21,23)(H,19,20,22) |
| InChIKey | LLWGPZOKTZTHAY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|