C17H21ClN4O4 — CID 109323660
N-(4-chloro-2,5-dimethoxyphenyl)-2-(2-methoxyethylamino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109323660) has the molecular formula C17H21ClN4O4 and a molecular weight of 380.83 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-(2-methoxyethylamino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(2-methoxyethylamino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109323660 |
| Molecular Formula | C17H21ClN4O4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(2-methoxyethylamino)-6-methylpyrimidine-4-carboxamide |
| SMILES | COCCNc1nc(C)cc(C(=O)Nc2cc(OC)c(Cl)cc2OC)n1 |
| InChI | InChI=1S/C17H21ClN4O4/c1-10-7-13(22-17(20-10)19-5-6-24-2)16(23)21-12-9-14(25-3)11(18)8-15(12)26-4/h7-9H,5-6H2,1-4H3,(H,21,23)(H,19,20,22) |
| InChIKey | IZQYJDAYYRPHHY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|