C19H20F3NO2 — CID 59487404
methyl 6-(4-methylphenyl)-2-(2-methylpropyl)-4-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 59487404) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is methyl 6-(4-methylphenyl)-2-(2-methylpropyl)-4-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 6-(4-methylphenyl)-2-(2-methylpropyl)-4-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59487404 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | methyl 6-(4-methylphenyl)-2-(2-methylpropyl)-4-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)(F)F)cc(-c2ccc(C)cc2)nc1CC(C)C |
| InChI | InChI=1S/C19H20F3NO2/c1-11(2)9-16-17(18(24)25-4)14(19(20,21)22)10-15(23-16)13-7-5-12(3)6-8-13/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | ZPWJKTDALFMEMD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |