C11H17Cl2N3O — CID 114137195
3,6-dichloro-N-(4-propan-2-yloxybutyl)pyridazin-4-amine (PubChem CID 114137195) has the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. Its IUPAC name is 3,6-dichloro-N-(4-propan-2-yloxybutyl)pyridazin-4-amine.
| Compound Name | 3,6-dichloro-N-(4-propan-2-yloxybutyl)pyridazin-4-amine |
|---|---|
| PubChem CID | 114137195 |
| Molecular Formula | C11H17Cl2N3O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3,6-dichloro-N-(4-propan-2-yloxybutyl)pyridazin-4-amine |
| SMILES | CC(C)OCCCCNc1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C11H17Cl2N3O/c1-8(2)17-6-4-3-5-14-9-7-10(12)15-16-11(9)13/h7-8H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | BZHHUTIWDCNGGY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|