C9H13ClN4O2 — CID 97073917
(2R)-2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-3-methoxypropanamide (PubChem CID 97073917) has the molecular formula C9H13ClN4O2 and a molecular weight of 244.68 g/mol. Its IUPAC name is (2R)-2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-3-methoxypropanamide.
| Compound Name | (2R)-2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-3-methoxypropanamide |
|---|---|
| PubChem CID | 97073917 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (2R)-2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-3-methoxypropanamide |
| SMILES | COC[C@@H](Nc1cc(Cl)nc(C)n1)C(N)=O |
| InChI | InChI=1S/C9H13ClN4O2/c1-5-12-7(10)3-8(13-5)14-6(4-16-2)9(11)15/h3,6H,4H2,1-2H3,(H2,11,15)(H,12,13,14)/t6-/m1/s1 |
| InChIKey | UAAFQKODOUWHHQ-ZCFIWIBFSA-N |
| XLogP | 0.35 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |