C12H15N5O — CID 112559967
2-[(6-hydrazinyl-2-phenylpyrimidin-4-yl)amino]ethanol (PubChem CID 112559967) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-2-phenylpyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[(6-hydrazinyl-2-phenylpyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 112559967 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[(6-hydrazinyl-2-phenylpyrimidin-4-yl)amino]ethanol |
| SMILES | NNc1cc(NCCO)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H15N5O/c13-17-11-8-10(14-6-7-18)15-12(16-11)9-4-2-1-3-5-9/h1-5,8,18H,6-7,13H2,(H2,14,15,16,17) |
| InChIKey | ZBQYEJVFOSEZQH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|