C14H19N5O2 — CID 115916179
2-[2-[(6-hydrazinyl-2-phenylpyrimidin-4-yl)amino]ethoxy]ethanol (PubChem CID 115916179) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[2-[(6-hydrazinyl-2-phenylpyrimidin-4-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(6-hydrazinyl-2-phenylpyrimidin-4-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 115916179 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-[2-[(6-hydrazinyl-2-phenylpyrimidin-4-yl)amino]ethoxy]ethanol |
| SMILES | NNc1cc(NCCOCCO)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H19N5O2/c15-19-13-10-12(16-6-8-21-9-7-20)17-14(18-13)11-4-2-1-3-5-11/h1-5,10,20H,6-9,15H2,(H2,16,17,18,19) |
| InChIKey | UIHLRECVUPXSFP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|