C10H15FN2OS — CID 103702970
3-[2-[(6-fluoro-2-pyridinyl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 103702970) has the molecular formula C10H15FN2OS and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[2-[(6-fluoro-2-pyridinyl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-fluoro-2-pyridinyl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 103702970 |
| Molecular Formula | C10H15FN2OS |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-[2-[(6-fluoro-2-pyridinyl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNc1cccc(F)n1 |
| InChI | InChI=1S/C10H15FN2OS/c11-9-3-1-4-10(13-9)12-5-8-15-7-2-6-14/h1,3-4,14H,2,5-8H2,(H,12,13) |
| InChIKey | NGPUDIMHUDVQNJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|