C14H16BrClN2OS — CID 133437196
3-[2-[(6-bromo-8-chloroquinolin-2-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 133437196) has the molecular formula C14H16BrClN2OS and a molecular weight of 375.72 g/mol. Its IUPAC name is 3-[2-[(6-bromo-8-chloroquinolin-2-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-bromo-8-chloroquinolin-2-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 133437196 |
| Molecular Formula | C14H16BrClN2OS |
| Molecular Weight | 375.72 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 3-[2-[(6-bromo-8-chloroquinolin-2-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNc1ccc2cc(Br)cc(Cl)c2n1 |
| InChI | InChI=1S/C14H16BrClN2OS/c15-11-8-10-2-3-13(18-14(10)12(16)9-11)17-4-7-20-6-1-5-19/h2-3,8-9,19H,1,4-7H2,(H,17,18) |
| InChIKey | IWWPCKRLAGUYDD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.72 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|