C9H17N5OS — CID 106311883
3-[2-[(6-hydrazinylpyrazin-2-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311883) has the molecular formula C9H17N5OS and a molecular weight of 243.34 g/mol. Its IUPAC name is 3-[2-[(6-hydrazinylpyrazin-2-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-hydrazinylpyrazin-2-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311883 |
| Molecular Formula | C9H17N5OS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-[2-[(6-hydrazinylpyrazin-2-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | NNc1cncc(NCCSCCCO)n1 |
| InChI | InChI=1S/C9H17N5OS/c10-14-9-7-11-6-8(13-9)12-2-5-16-4-1-3-15/h6-7,15H,1-5,10H2,(H2,12,13,14) |
| InChIKey | MOZUDPOWUBUQTL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|