C9H15N3OS — CID 79232930
3-[(6-hydrazinyl-2-pyridinyl)methylsulfanyl]propan-1-ol (PubChem CID 79232930) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-2-pyridinyl)methylsulfanyl]propan-1-ol.
| Compound Name | 3-[(6-hydrazinyl-2-pyridinyl)methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 79232930 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-[(6-hydrazinyl-2-pyridinyl)methylsulfanyl]propan-1-ol |
| SMILES | NNc1cccc(CSCCCO)n1 |
| InChI | InChI=1S/C9H15N3OS/c10-12-9-4-1-3-8(11-9)7-14-6-2-5-13/h1,3-4,13H,2,5-7,10H2,(H,11,12) |
| InChIKey | YJHDEHFGKDTFGW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|