C10H14N6S — CID 79232663
[6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-pyridinyl]hydrazine (PubChem CID 79232663) has the molecular formula C10H14N6S and a molecular weight of 250.33 g/mol. Its IUPAC name is [6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-pyridinyl]hydrazine.
| Compound Name | [6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79232663 |
| Molecular Formula | C10H14N6S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-pyridinyl]hydrazine |
| SMILES | Cc1nnc(SCc2cccc(NN)n2)n1C |
| InChI | InChI=1S/C10H14N6S/c1-7-14-15-10(16(7)2)17-6-8-4-3-5-9(12-8)13-11/h3-5H,6,11H2,1-2H3,(H,12,13) |
| InChIKey | KTGLQFIYFLFUKI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|